C12H15NO4 — CID 175288153
(3R,3aR,6R,6aS)-6-(1H-azepin-2-yl)-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-3,6-diol (PubChem CID 175288153) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is (3R,3aR,6R,6aS)-6-(1H-azepin-2-yl)-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-3,6-diol.
| Compound Name | (3R,3aR,6R,6aS)-6-(1H-azepin-2-yl)-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-3,6-diol |
|---|---|
| PubChem CID | 175288153 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | (3R,3aR,6R,6aS)-6-(1H-azepin-2-yl)-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-3,6-diol |
| SMILES | O[C@@H]1CO[C@H]2[C@@H]1OC[C@]2(O)C1=CC=CC=CN1 |
| InChI | InChI=1S/C12H15NO4/c14-8-6-16-11-10(8)17-7-12(11,15)9-4-2-1-3-5-13-9/h1-5,8,10-11,13-15H,6-7H2/t8-,10-,11+,12+/m1/s1 |
| InChIKey | XEJMQRIRRONKFZ-YJQGPUDQSA-N |
| XLogP | -0.57 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |