C54H45N — CID 175290151
tris(1,1'-biphenyl);N,N-diphenylaniline (PubChem CID 175290151) has the molecular formula C54H45N and a molecular weight of 707.96 g/mol. Its IUPAC name is tris(1,1'-biphenyl);N,N-diphenylaniline.
| Compound Name | tris(1,1'-biphenyl);N,N-diphenylaniline |
|---|---|
| PubChem CID | 175290151 |
| Molecular Formula | C54H45N |
| Molecular Weight | 707.96 g/mol |
| Exact Mass | 707.36 |
| IUPAC Name | tris(1,1'-biphenyl);N,N-diphenylaniline |
| SMILES | c1ccc(-c2ccccc2)cc1.c1ccc(-c2ccccc2)cc1.c1ccc(-c2ccccc2)cc1.c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15N.3C12H10/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;3*1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-15H;3*1-10H |
| InChIKey | YMSHTMRDOVTZHI-UHFFFAOYSA-N |
| XLogP | 15.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.96 |
| LogP ≤ 5 | 15.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |