About azane;3-methyl-2-oxopyrrolidine-1-carboxylic acid
azane;3-methyl-2-oxopyrrolidine-1-carboxylic acid (PubChem CID 175290207) has the molecular formula C6H12N2O3
and a molecular weight of 160.17 g/mol. Its IUPAC name is azane;3-methyl-2-oxopyrrolidine-1-carboxylic acid.
Molecular Properties
| Compound Name | azane;3-methyl-2-oxopyrrolidine-1-carboxylic acid |
| PubChem CID | 175290207 |
| Molecular Formula | C6H12N2O3 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.08 |
| IUPAC Name | azane;3-methyl-2-oxopyrrolidine-1-carboxylic acid |
| SMILES | CC1CCN(C(=O)O)C1=O.N |
| InChI | InChI=1S/C6H9NO3.H3N/c1-4-2-3-7(5(4)8)6(9)10;/h4H,2-3H2,1H3,(H,9,10);1H3 |
| InChIKey | HOZZGOOYXAEZRQ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 92.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;3-methyl-2-oxopyrrolidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3-methyl-2-oxopyrrolidine-1-carboxylic acid?
The IUPAC name of azane;3-methyl-2-oxopyrrolidine-1-carboxylic acid (CID 175290207) is azane;3-methyl-2-oxopyrrolidine-1-carboxylic acid.
What is the SMILES notation for azane;3-methyl-2-oxopyrrolidine-1-carboxylic acid?
The canonical SMILES for azane;3-methyl-2-oxopyrrolidine-1-carboxylic acid is CC1CCN(C(=O)O)C1=O.N.
What is the InChIKey of azane;3-methyl-2-oxopyrrolidine-1-carboxylic acid?
The InChIKey is HOZZGOOYXAEZRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3.H3N/c1-4-2-3-7(5(4)8)6(9)10;/h4H,2-3H2,1H3,(H,9,10);1H3.
What are the key properties of azane;3-methyl-2-oxopyrrolidine-1-carboxylic acid?
azane;3-methyl-2-oxopyrrolidine-1-carboxylic acid has a molecular weight of 160.17 g/mol, XLogP of 0.69, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3-methyl-2-oxopyrrolidine-1-carboxylic acid is sourced from PubChem (CID 175290207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).