About 4-fluoro-3,4-dihydro-1H-isoquinoline-2,8-dicarboxylic acid
4-fluoro-3,4-dihydro-1H-isoquinoline-2,8-dicarboxylic acid (PubChem CID 175291059) has the molecular formula C11H10FNO4
and a molecular weight of 239.20 g/mol. Its IUPAC name is 4-fluoro-3,4-dihydro-1H-isoquinoline-2,8-dicarboxylic acid.
Molecular Properties
| Compound Name | 4-fluoro-3,4-dihydro-1H-isoquinoline-2,8-dicarboxylic acid |
| PubChem CID | 175291059 |
| Molecular Formula | C11H10FNO4 |
| Molecular Weight | 239.20 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 4-fluoro-3,4-dihydro-1H-isoquinoline-2,8-dicarboxylic acid |
| SMILES | O=C(O)c1cccc2c1CN(C(=O)O)CC2F |
| InChI | InChI=1S/C11H10FNO4/c12-9-5-13(11(16)17)4-8-6(9)2-1-3-7(8)10(14)15/h1-3,9H,4-5H2,(H,14,15)(H,16,17) |
| InChIKey | RTVIEMHVIRVICX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.20 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-fluoro-3,4-dihydro-1H-isoquinoline-2,8-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-3,4-dihydro-1H-isoquinoline-2,8-dicarboxylic acid?
The IUPAC name of 4-fluoro-3,4-dihydro-1H-isoquinoline-2,8-dicarboxylic acid (CID 175291059) is 4-fluoro-3,4-dihydro-1H-isoquinoline-2,8-dicarboxylic acid.
What is the SMILES notation for 4-fluoro-3,4-dihydro-1H-isoquinoline-2,8-dicarboxylic acid?
The canonical SMILES for 4-fluoro-3,4-dihydro-1H-isoquinoline-2,8-dicarboxylic acid is O=C(O)c1cccc2c1CN(C(=O)O)CC2F.
What is the InChIKey of 4-fluoro-3,4-dihydro-1H-isoquinoline-2,8-dicarboxylic acid?
The InChIKey is RTVIEMHVIRVICX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FNO4/c12-9-5-13(11(16)17)4-8-6(9)2-1-3-7(8)10(14)15/h1-3,9H,4-5H2,(H,14,15)(H,16,17).
What are the key properties of 4-fluoro-3,4-dihydro-1H-isoquinoline-2,8-dicarboxylic acid?
4-fluoro-3,4-dihydro-1H-isoquinoline-2,8-dicarboxylic acid has a molecular weight of 239.20 g/mol, XLogP of 1.89, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-3,4-dihydro-1H-isoquinoline-2,8-dicarboxylic acid is sourced from PubChem (CID 175291059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).