C33H32N2O6 — CID 175291233
4-[[2-[[4-[C-[3-(aminomethyl)phenyl]-N-methoxycarbonimidoyl]-2-methylphenoxy]methyl]-3-methylphenyl]methyl]benzene-1,3-dicarboxylic acid (PubChem CID 175291233) has the molecular formula C33H32N2O6 and a molecular weight of 552.63 g/mol. Its IUPAC name is 4-[[2-[[4-[C-[3-(aminomethyl)phenyl]-N-methoxycarbonimidoyl]-2-methylphenoxy]methyl]-3-methylphenyl]methyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 4-[[2-[[4-[C-[3-(aminomethyl)phenyl]-N-methoxycarbonimidoyl]-2-methylphenoxy]methyl]-3-methylphenyl]methyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 175291233 |
| Molecular Formula | C33H32N2O6 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | 4-[[2-[[4-[C-[3-(aminomethyl)phenyl]-N-methoxycarbonimidoyl]-2-methylphenoxy]methyl]-3-methylphenyl]methyl]benzene-1,3-dicarboxylic acid |
| SMILES | CON=C(c1cccc(CN)c1)c1ccc(OCc2c(C)cccc2Cc2ccc(C(=O)O)cc2C(=O)O)c(C)c1 |
| InChI | InChI=1S/C33H32N2O6/c1-20-6-4-8-23(16-24-10-11-27(32(36)37)17-28(24)33(38)39)29(20)19-41-30-13-12-26(14-21(30)2)31(35-40-3)25-9-5-7-22(15-25)18-34/h4-15,17H,16,18-19,34H2,1-3H3,(H,36,37)(H,38,39) |
| InChIKey | PFQHGPXYCLYIQE-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 131.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|