C11H20O6 — CID 175291581
acetyl prop-2-enoate;2-ethyl-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 175291581) has the molecular formula C11H20O6 and a molecular weight of 248.27 g/mol. Its IUPAC name is acetyl prop-2-enoate;2-ethyl-2-(hydroxymethyl)propane-1,3-diol.
| Compound Name | acetyl prop-2-enoate;2-ethyl-2-(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 175291581 |
| Molecular Formula | C11H20O6 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | acetyl prop-2-enoate;2-ethyl-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | C=CC(=O)OC(C)=O.CCC(CO)(CO)CO |
| InChI | InChI=1S/C6H14O3.C5H6O3/c1-2-6(3-7,4-8)5-9;1-3-5(7)8-4(2)6/h7-9H,2-5H2,1H3;3H,1H2,2H3 |
| InChIKey | WPSHLLGSMSZTEU-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|