C42H85N — CID 175292627
azane;(9Z,29Z)-19-tert-butyloctatriaconta-9,29-diene (PubChem CID 175292627) has the molecular formula C42H85N and a molecular weight of 604.15 g/mol. Its IUPAC name is azane;(9Z,29Z)-19-tert-butyloctatriaconta-9,29-diene.
| Compound Name | azane;(9Z,29Z)-19-tert-butyloctatriaconta-9,29-diene |
|---|---|
| PubChem CID | 175292627 |
| Molecular Formula | C42H85N |
| Molecular Weight | 604.15 g/mol |
| Exact Mass | 603.67 |
| IUPAC Name | azane;(9Z,29Z)-19-tert-butyloctatriaconta-9,29-diene |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(CCCCCCCC/C=C\CCCCCCCC)C(C)(C)C.N |
| InChI | InChI=1S/C42H82.H3N/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-40-41(42(3,4)5)39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2;/h20-23,41H,6-19,24-40H2,1-5H3;1H3/b22-20-,23-21-; |
| InChIKey | OLBBFSKHLUCUCE-LQDDAWAPSA-N |
| XLogP | 16.06 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.15 |
| LogP ≤ 5 | 16.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|