C17H34N4O3 — CID 175293033
5-(hydroxymethyl)-4-(2-phenylethyl)morpholine-3-carbaldehyde;methanamine (PubChem CID 175293033) has the molecular formula C17H34N4O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is 5-(hydroxymethyl)-4-(2-phenylethyl)morpholine-3-carbaldehyde;methanamine.
| Compound Name | 5-(hydroxymethyl)-4-(2-phenylethyl)morpholine-3-carbaldehyde;methanamine |
|---|---|
| PubChem CID | 175293033 |
| Molecular Formula | C17H34N4O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | 5-(hydroxymethyl)-4-(2-phenylethyl)morpholine-3-carbaldehyde;methanamine |
| SMILES | CN.CN.CN.O=CC1COCC(CO)N1CCc1ccccc1 |
| InChI | InChI=1S/C14H19NO3.3CH5N/c16-8-13-10-18-11-14(9-17)15(13)7-6-12-4-2-1-3-5-12;3*1-2/h1-5,8,13-14,17H,6-7,9-11H2;3*2H2,1H3 |
| InChIKey | NOMGVQQBVWBLHQ-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 127.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|