C27H56O3 — CID 175293124
3-octoxy-3-octylundecane-1,2-diol (PubChem CID 175293124) has the molecular formula C27H56O3 and a molecular weight of 428.74 g/mol. Its IUPAC name is 3-octoxy-3-octylundecane-1,2-diol.
| Compound Name | 3-octoxy-3-octylundecane-1,2-diol |
|---|---|
| PubChem CID | 175293124 |
| Molecular Formula | C27H56O3 |
| Molecular Weight | 428.74 g/mol |
| Exact Mass | 428.42 |
| IUPAC Name | 3-octoxy-3-octylundecane-1,2-diol |
| SMILES | CCCCCCCCOC(CCCCCCCC)(CCCCCCCC)C(O)CO |
| InChI | InChI=1S/C27H56O3/c1-4-7-10-13-16-19-22-27(26(29)25-28,23-20-17-14-11-8-5-2)30-24-21-18-15-12-9-6-3/h26,28-29H,4-25H2,1-3H3 |
| InChIKey | SZLHYYXBEHREPB-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.74 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|