About potassium;propylcyclohexane;trifluoroborane
potassium;propylcyclohexane;trifluoroborane (PubChem CID 175293247) has the molecular formula C9H17BF3K
and a molecular weight of 232.14 g/mol. Its IUPAC name is potassium;propylcyclohexane;trifluoroborane.
Molecular Properties
| Compound Name | potassium;propylcyclohexane;trifluoroborane |
| PubChem CID | 175293247 |
| Molecular Formula | C9H17BF3K |
| Molecular Weight | 232.14 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | potassium;propylcyclohexane;trifluoroborane |
| SMILES | FB(F)F.[CH2-]CCC1CCCCC1.[K+] |
| InChI | InChI=1S/C9H17.BF3.K/c1-2-6-9-7-4-3-5-8-9;2-1(3)4;/h9H,1-8H2;;/q-1;;+1 |
| InChIKey | DCTFPLOQGNBBLG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.14 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium;propylcyclohexane;trifluoroborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;propylcyclohexane;trifluoroborane?
The IUPAC name of potassium;propylcyclohexane;trifluoroborane (CID 175293247) is potassium;propylcyclohexane;trifluoroborane.
What is the SMILES notation for potassium;propylcyclohexane;trifluoroborane?
The canonical SMILES for potassium;propylcyclohexane;trifluoroborane is FB(F)F.[CH2-]CCC1CCCCC1.[K+].
What is the InChIKey of potassium;propylcyclohexane;trifluoroborane?
The InChIKey is DCTFPLOQGNBBLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17.BF3.K/c1-2-6-9-7-4-3-5-8-9;2-1(3)4;/h9H,1-8H2;;/q-1;;+1.
What are the key properties of potassium;propylcyclohexane;trifluoroborane?
potassium;propylcyclohexane;trifluoroborane has a molecular weight of 232.14 g/mol, XLogP of 1.06, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;propylcyclohexane;trifluoroborane is sourced from PubChem (CID 175293247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).