About (8-iodo-2-methylsulfanyl-9H-pyrrolo[3,2-h]quinazolin-7-yl) acetate
(8-iodo-2-methylsulfanyl-9H-pyrrolo[3,2-h]quinazolin-7-yl) acetate (PubChem CID 175293807) has the molecular formula C13H10IN3O2S
and a molecular weight of 399.21 g/mol. Its IUPAC name is (8-iodo-2-methylsulfanyl-9H-pyrrolo[3,2-h]quinazolin-7-yl) acetate.
Molecular Properties
| Compound Name | (8-iodo-2-methylsulfanyl-9H-pyrrolo[3,2-h]quinazolin-7-yl) acetate |
| PubChem CID | 175293807 |
| Molecular Formula | C13H10IN3O2S |
| Molecular Weight | 399.21 g/mol |
| Exact Mass | 398.95 |
| IUPAC Name | (8-iodo-2-methylsulfanyl-9H-pyrrolo[3,2-h]quinazolin-7-yl) acetate |
| SMILES | CSc1ncc2ccc3c(OC(C)=O)c(I)[nH]c3c2n1 |
| InChI | InChI=1S/C13H10IN3O2S/c1-6(18)19-11-8-4-3-7-5-15-13(20-2)17-9(7)10(8)16-12(11)14/h3-5,16H,1-2H3 |
| InChIKey | NJWBSFAVYXJEHP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.21 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (8-iodo-2-methylsulfanyl-9H-pyrrolo[3,2-h]quinazolin-7-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-iodo-2-methylsulfanyl-9H-pyrrolo[3,2-h]quinazolin-7-yl) acetate?
The IUPAC name of (8-iodo-2-methylsulfanyl-9H-pyrrolo[3,2-h]quinazolin-7-yl) acetate (CID 175293807) is (8-iodo-2-methylsulfanyl-9H-pyrrolo[3,2-h]quinazolin-7-yl) acetate.
What is the SMILES notation for (8-iodo-2-methylsulfanyl-9H-pyrrolo[3,2-h]quinazolin-7-yl) acetate?
The canonical SMILES for (8-iodo-2-methylsulfanyl-9H-pyrrolo[3,2-h]quinazolin-7-yl) acetate is CSc1ncc2ccc3c(OC(C)=O)c(I)[nH]c3c2n1.
What is the InChIKey of (8-iodo-2-methylsulfanyl-9H-pyrrolo[3,2-h]quinazolin-7-yl) acetate?
The InChIKey is NJWBSFAVYXJEHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10IN3O2S/c1-6(18)19-11-8-4-3-7-5-15-13(20-2)17-9(7)10(8)16-12(11)14/h3-5,16H,1-2H3.
What are the key properties of (8-iodo-2-methylsulfanyl-9H-pyrrolo[3,2-h]quinazolin-7-yl) acetate?
(8-iodo-2-methylsulfanyl-9H-pyrrolo[3,2-h]quinazolin-7-yl) acetate has a molecular weight of 399.21 g/mol, XLogP of 3.36, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (8-iodo-2-methylsulfanyl-9H-pyrrolo[3,2-h]quinazolin-7-yl) acetate is sourced from PubChem (CID 175293807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).