C31H44N2O2 — CID 175293948
N-[1-[(4S,5S)-4-benzyl-5-(3,5-ditert-butylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]-2,2-dimethylpropyl]acetamide (PubChem CID 175293948) has the molecular formula C31H44N2O2 and a molecular weight of 476.71 g/mol. Its IUPAC name is N-[1-[(4S,5S)-4-benzyl-5-(3,5-ditert-butylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]-2,2-dimethylpropyl]acetamide.
| Compound Name | N-[1-[(4S,5S)-4-benzyl-5-(3,5-ditert-butylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]-2,2-dimethylpropyl]acetamide |
|---|---|
| PubChem CID | 175293948 |
| Molecular Formula | C31H44N2O2 |
| Molecular Weight | 476.71 g/mol |
| Exact Mass | 476.34 |
| IUPAC Name | N-[1-[(4S,5S)-4-benzyl-5-(3,5-ditert-butylphenyl)-4,5-dihydro-1,3-oxazol-2-yl]-2,2-dimethylpropyl]acetamide |
| SMILES | CC(=O)NC(C1=N[C@@H](Cc2ccccc2)[C@H](c2cc(C(C)(C)C)cc(C(C)(C)C)c2)O1)C(C)(C)C |
| InChI | InChI=1S/C31H44N2O2/c1-20(34)32-27(31(8,9)10)28-33-25(16-21-14-12-11-13-15-21)26(35-28)22-17-23(29(2,3)4)19-24(18-22)30(5,6)7/h11-15,17-19,25-27H,16H2,1-10H3,(H,32,34)/t25-,26-,27?/m0/s1 |
| InChIKey | OONLNJBJAHIJMC-TXIPYEPDSA-N |
| XLogP | 6.91 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.71 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |