About 1-[1-pyrazol-1-yl-1-(1,3-thiazol-4-yl)ethyl]-3-(trifluoromethyl)pyrazole-4-carboxylic acid
1-[1-pyrazol-1-yl-1-(1,3-thiazol-4-yl)ethyl]-3-(trifluoromethyl)pyrazole-4-carboxylic acid (PubChem CID 175294793) has the molecular formula C13H10F3N5O2S
and a molecular weight of 357.32 g/mol. Its IUPAC name is 1-[1-pyrazol-1-yl-1-(1,3-thiazol-4-yl)ethyl]-3-(trifluoromethyl)pyrazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[1-pyrazol-1-yl-1-(1,3-thiazol-4-yl)ethyl]-3-(trifluoromethyl)pyrazole-4-carboxylic acid |
| PubChem CID | 175294793 |
| Molecular Formula | C13H10F3N5O2S |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 1-[1-pyrazol-1-yl-1-(1,3-thiazol-4-yl)ethyl]-3-(trifluoromethyl)pyrazole-4-carboxylic acid |
| SMILES | CC(c1cscn1)(n1cccn1)n1cc(C(=O)O)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H10F3N5O2S/c1-12(9-6-24-7-17-9,20-4-2-3-18-20)21-5-8(11(22)23)10(19-21)13(14,15)16/h2-7H,1H3,(H,22,23) |
| InChIKey | COYZBFGCVUAUSM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[1-pyrazol-1-yl-1-(1,3-thiazol-4-yl)ethyl]-3-(trifluoromethyl)pyrazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-pyrazol-1-yl-1-(1,3-thiazol-4-yl)ethyl]-3-(trifluoromethyl)pyrazole-4-carboxylic acid?
The IUPAC name of 1-[1-pyrazol-1-yl-1-(1,3-thiazol-4-yl)ethyl]-3-(trifluoromethyl)pyrazole-4-carboxylic acid (CID 175294793) is 1-[1-pyrazol-1-yl-1-(1,3-thiazol-4-yl)ethyl]-3-(trifluoromethyl)pyrazole-4-carboxylic acid.
What is the SMILES notation for 1-[1-pyrazol-1-yl-1-(1,3-thiazol-4-yl)ethyl]-3-(trifluoromethyl)pyrazole-4-carboxylic acid?
The canonical SMILES for 1-[1-pyrazol-1-yl-1-(1,3-thiazol-4-yl)ethyl]-3-(trifluoromethyl)pyrazole-4-carboxylic acid is CC(c1cscn1)(n1cccn1)n1cc(C(=O)O)c(C(F)(F)F)n1.
What is the InChIKey of 1-[1-pyrazol-1-yl-1-(1,3-thiazol-4-yl)ethyl]-3-(trifluoromethyl)pyrazole-4-carboxylic acid?
The InChIKey is COYZBFGCVUAUSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10F3N5O2S/c1-12(9-6-24-7-17-9,20-4-2-3-18-20)21-5-8(11(22)23)10(19-21)13(14,15)16/h2-7H,1H3,(H,22,23).
What are the key properties of 1-[1-pyrazol-1-yl-1-(1,3-thiazol-4-yl)ethyl]-3-(trifluoromethyl)pyrazole-4-carboxylic acid?
1-[1-pyrazol-1-yl-1-(1,3-thiazol-4-yl)ethyl]-3-(trifluoromethyl)pyrazole-4-carboxylic acid has a molecular weight of 357.32 g/mol, XLogP of 2.52, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-pyrazol-1-yl-1-(1,3-thiazol-4-yl)ethyl]-3-(trifluoromethyl)pyrazole-4-carboxylic acid is sourced from PubChem (CID 175294793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).