C23H34O3Si — CID 175295095
1,1'-biphenyl;1,1,2-triethoxysilinane (PubChem CID 175295095) has the molecular formula C23H34O3Si and a molecular weight of 386.61 g/mol. Its IUPAC name is 1,1'-biphenyl;1,1,2-triethoxysilinane.
| Compound Name | 1,1'-biphenyl;1,1,2-triethoxysilinane |
|---|---|
| PubChem CID | 175295095 |
| Molecular Formula | C23H34O3Si |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 1,1'-biphenyl;1,1,2-triethoxysilinane |
| SMILES | CCOC1CCCC[Si]1(OCC)OCC.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C11H24O3Si/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-4-12-11-9-7-8-10-15(11,13-5-2)14-6-3/h1-10H;11H,4-10H2,1-3H3 |
| InChIKey | YORVDNGHODKFPG-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|