C12H11N3O4 — CID 175295146
dimethyl 2-(2H-triazol-4-yl)benzene-1,4-dicarboxylate (PubChem CID 175295146) has the molecular formula C12H11N3O4 and a molecular weight of 261.24 g/mol. Its IUPAC name is dimethyl 2-(2H-triazol-4-yl)benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-(2H-triazol-4-yl)benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 175295146 |
| Molecular Formula | C12H11N3O4 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | dimethyl 2-(2H-triazol-4-yl)benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(-c2cn[nH]n2)c1 |
| InChI | InChI=1S/C12H11N3O4/c1-18-11(16)7-3-4-8(12(17)19-2)9(5-7)10-6-13-15-14-10/h3-6H,1-2H3,(H,13,14,15) |
| InChIKey | UBWVRWTVTLRRES-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |