C20H15FN2O10S — CID 175295548
5-fluoro-1-(4-methylphenyl)sulfonyl-3-(4-nitrophenyl)-3H-pyrrole-2,2,4-tricarboxylic acid (PubChem CID 175295548) has the molecular formula C20H15FN2O10S and a molecular weight of 494.41 g/mol. Its IUPAC name is 5-fluoro-1-(4-methylphenyl)sulfonyl-3-(4-nitrophenyl)-3H-pyrrole-2,2,4-tricarboxylic acid.
| Compound Name | 5-fluoro-1-(4-methylphenyl)sulfonyl-3-(4-nitrophenyl)-3H-pyrrole-2,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 175295548 |
| Molecular Formula | C20H15FN2O10S |
| Molecular Weight | 494.41 g/mol |
| Exact Mass | 494.04 |
| IUPAC Name | 5-fluoro-1-(4-methylphenyl)sulfonyl-3-(4-nitrophenyl)-3H-pyrrole-2,2,4-tricarboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)N2C(F)=C(C(=O)O)C(c3ccc([N+](=O)[O-])cc3)C2(C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C20H15FN2O10S/c1-10-2-8-13(9-3-10)34(32,33)22-16(21)14(17(24)25)15(20(22,18(26)27)19(28)29)11-4-6-12(7-5-11)23(30)31/h2-9,15H,1H3,(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | PJCXZMIUEHXUJQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 192.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|