About 1,3,5-triazin-2-yl naphthalene-1-sulfonate
1,3,5-triazin-2-yl naphthalene-1-sulfonate (PubChem CID 175295881) has the molecular formula C13H9N3O3S
and a molecular weight of 287.30 g/mol. Its IUPAC name is 1,3,5-triazin-2-yl naphthalene-1-sulfonate.
Molecular Properties
| Compound Name | 1,3,5-triazin-2-yl naphthalene-1-sulfonate |
| PubChem CID | 175295881 |
| Molecular Formula | C13H9N3O3S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 1,3,5-triazin-2-yl naphthalene-1-sulfonate |
| SMILES | O=S(=O)(Oc1ncncn1)c1cccc2ccccc12 |
| InChI | InChI=1S/C13H9N3O3S/c17-20(18,19-13-15-8-14-9-16-13)12-7-3-5-10-4-1-2-6-11(10)12/h1-9H |
| InChIKey | ROVVOWSIZVVFGS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 82.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 1,3,5-triazin-2-yl naphthalene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,5-triazin-2-yl naphthalene-1-sulfonate?
The IUPAC name of 1,3,5-triazin-2-yl naphthalene-1-sulfonate (CID 175295881) is 1,3,5-triazin-2-yl naphthalene-1-sulfonate.
What is the SMILES notation for 1,3,5-triazin-2-yl naphthalene-1-sulfonate?
The canonical SMILES for 1,3,5-triazin-2-yl naphthalene-1-sulfonate is O=S(=O)(Oc1ncncn1)c1cccc2ccccc12.
What is the InChIKey of 1,3,5-triazin-2-yl naphthalene-1-sulfonate?
The InChIKey is ROVVOWSIZVVFGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3O3S/c17-20(18,19-13-15-8-14-9-16-13)12-7-3-5-10-4-1-2-6-11(10)12/h1-9H.
What are the key properties of 1,3,5-triazin-2-yl naphthalene-1-sulfonate?
1,3,5-triazin-2-yl naphthalene-1-sulfonate has a molecular weight of 287.30 g/mol, XLogP of 1.79, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,5-triazin-2-yl naphthalene-1-sulfonate is sourced from PubChem (CID 175295881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).