About [5-(4-fluoro-3-methylphenyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate
[5-(4-fluoro-3-methylphenyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate (PubChem CID 175296596) has the molecular formula C19H20FNO2
and a molecular weight of 313.37 g/mol. Its IUPAC name is [5-(4-fluoro-3-methylphenyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate.
Molecular Properties
| Compound Name | [5-(4-fluoro-3-methylphenyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate |
| PubChem CID | 175296596 |
| Molecular Formula | C19H20FNO2 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | [5-(4-fluoro-3-methylphenyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate |
| SMILES | Cc1cc(-c2ccc3c(c2)CC(C)(C)C3OC(N)=O)ccc1F |
| InChI | InChI=1S/C19H20FNO2/c1-11-8-12(5-7-16(11)20)13-4-6-15-14(9-13)10-19(2,3)17(15)23-18(21)22/h4-9,17H,10H2,1-3H3,(H2,21,22) |
| InChIKey | KVMJGIZVTAWCMX-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [5-(4-fluoro-3-methylphenyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-fluoro-3-methylphenyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate?
The IUPAC name of [5-(4-fluoro-3-methylphenyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate (CID 175296596) is [5-(4-fluoro-3-methylphenyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate.
What is the SMILES notation for [5-(4-fluoro-3-methylphenyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate?
The canonical SMILES for [5-(4-fluoro-3-methylphenyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate is Cc1cc(-c2ccc3c(c2)CC(C)(C)C3OC(N)=O)ccc1F.
What is the InChIKey of [5-(4-fluoro-3-methylphenyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate?
The InChIKey is KVMJGIZVTAWCMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20FNO2/c1-11-8-12(5-7-16(11)20)13-4-6-15-14(9-13)10-19(2,3)17(15)23-18(21)22/h4-9,17H,10H2,1-3H3,(H2,21,22).
What are the key properties of [5-(4-fluoro-3-methylphenyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate?
[5-(4-fluoro-3-methylphenyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate has a molecular weight of 313.37 g/mol, XLogP of 4.52, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-fluoro-3-methylphenyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate is sourced from PubChem (CID 175296596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).