C21H26N2O3 — CID 175296625
[5-(6-butoxy-3-pyridinyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate (PubChem CID 175296625) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is [5-(6-butoxy-3-pyridinyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate.
| Compound Name | [5-(6-butoxy-3-pyridinyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate |
|---|---|
| PubChem CID | 175296625 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | [5-(6-butoxy-3-pyridinyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate |
| SMILES | CCCCOc1ccc(-c2ccc3c(c2)CC(C)(C)C3OC(N)=O)cn1 |
| InChI | InChI=1S/C21H26N2O3/c1-4-5-10-25-18-9-7-15(13-23-18)14-6-8-17-16(11-14)12-21(2,3)19(17)26-20(22)24/h6-9,11,13,19H,4-5,10,12H2,1-3H3,(H2,22,24) |
| InChIKey | OEINJMMACOGFTQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|