C18H17F2NO2 — CID 175296645
[6-(3,4-difluorophenyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate (PubChem CID 175296645) has the molecular formula C18H17F2NO2 and a molecular weight of 317.34 g/mol. Its IUPAC name is [6-(3,4-difluorophenyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate.
| Compound Name | [6-(3,4-difluorophenyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate |
|---|---|
| PubChem CID | 175296645 |
| Molecular Formula | C18H17F2NO2 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | [6-(3,4-difluorophenyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate |
| SMILES | CC1(C)Cc2ccc(-c3ccc(F)c(F)c3)cc2C1OC(N)=O |
| InChI | InChI=1S/C18H17F2NO2/c1-18(2)9-12-4-3-10(7-13(12)16(18)23-17(21)22)11-5-6-14(19)15(20)8-11/h3-8,16H,9H2,1-2H3,(H2,21,22) |
| InChIKey | QCJZLXYGZMXZTB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |