About (5-isoquinolin-8-yl-2,2-dimethyl-1,3-dihydroinden-1-yl) carbamate
(5-isoquinolin-8-yl-2,2-dimethyl-1,3-dihydroinden-1-yl) carbamate (PubChem CID 175296731) has the molecular formula C21H20N2O2
and a molecular weight of 332.40 g/mol. Its IUPAC name is (5-isoquinolin-8-yl-2,2-dimethyl-1,3-dihydroinden-1-yl) carbamate.
Molecular Properties
| Compound Name | (5-isoquinolin-8-yl-2,2-dimethyl-1,3-dihydroinden-1-yl) carbamate |
| PubChem CID | 175296731 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | (5-isoquinolin-8-yl-2,2-dimethyl-1,3-dihydroinden-1-yl) carbamate |
| SMILES | CC1(C)Cc2cc(-c3cccc4ccncc34)ccc2C1OC(N)=O |
| InChI | InChI=1S/C21H20N2O2/c1-21(2)11-15-10-14(6-7-17(15)19(21)25-20(22)24)16-5-3-4-13-8-9-23-12-18(13)16/h3-10,12,19H,11H2,1-2H3,(H2,22,24) |
| InChIKey | QOIVBLAQMATGDV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-isoquinolin-8-yl-2,2-dimethyl-1,3-dihydroinden-1-yl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-isoquinolin-8-yl-2,2-dimethyl-1,3-dihydroinden-1-yl) carbamate?
The IUPAC name of (5-isoquinolin-8-yl-2,2-dimethyl-1,3-dihydroinden-1-yl) carbamate (CID 175296731) is (5-isoquinolin-8-yl-2,2-dimethyl-1,3-dihydroinden-1-yl) carbamate.
What is the SMILES notation for (5-isoquinolin-8-yl-2,2-dimethyl-1,3-dihydroinden-1-yl) carbamate?
The canonical SMILES for (5-isoquinolin-8-yl-2,2-dimethyl-1,3-dihydroinden-1-yl) carbamate is CC1(C)Cc2cc(-c3cccc4ccncc34)ccc2C1OC(N)=O.
What is the InChIKey of (5-isoquinolin-8-yl-2,2-dimethyl-1,3-dihydroinden-1-yl) carbamate?
The InChIKey is QOIVBLAQMATGDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O2/c1-21(2)11-15-10-14(6-7-17(15)19(21)25-20(22)24)16-5-3-4-13-8-9-23-12-18(13)16/h3-10,12,19H,11H2,1-2H3,(H2,22,24).
What are the key properties of (5-isoquinolin-8-yl-2,2-dimethyl-1,3-dihydroinden-1-yl) carbamate?
(5-isoquinolin-8-yl-2,2-dimethyl-1,3-dihydroinden-1-yl) carbamate has a molecular weight of 332.40 g/mol, XLogP of 4.62, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-isoquinolin-8-yl-2,2-dimethyl-1,3-dihydroinden-1-yl) carbamate is sourced from PubChem (CID 175296731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).