C9H10N2O4 — CID 175296770
1,3-diazinane-2,4,6-trione;2H-pyran (PubChem CID 175296770) has the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. Its IUPAC name is 1,3-diazinane-2,4,6-trione;2H-pyran.
| Compound Name | 1,3-diazinane-2,4,6-trione;2H-pyran |
|---|---|
| PubChem CID | 175296770 |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 1,3-diazinane-2,4,6-trione;2H-pyran |
| SMILES | C1=CCOC=C1.O=C1CC(=O)NC(=O)N1 |
| InChI | InChI=1S/C5H6O.C4H4N2O3/c1-2-4-6-5-3-1;7-2-1-3(8)6-4(9)5-2/h1-4H,5H2;1H2,(H2,5,6,7,8,9) |
| InChIKey | LUUBVDYJHUABSY-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|