C23H19ClF5N5O3 — CID 175297001
4-(4-chlorophenyl)-1-[[1-(2,5-difluorophenyl)-5-(1-hydroxyethyl)-1,2,4-triazol-3-yl]methyl]-3-(3,3,3-trifluoro-2-hydroxypropyl)imidazol-2-one (PubChem CID 175297001) has the molecular formula C23H19ClF5N5O3 and a molecular weight of 543.88 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-[[1-(2,5-difluorophenyl)-5-(1-hydroxyethyl)-1,2,4-triazol-3-yl]methyl]-3-(3,3,3-trifluoro-2-hydroxypropyl)imidazol-2-one.
| Compound Name | 4-(4-chlorophenyl)-1-[[1-(2,5-difluorophenyl)-5-(1-hydroxyethyl)-1,2,4-triazol-3-yl]methyl]-3-(3,3,3-trifluoro-2-hydroxypropyl)imidazol-2-one |
|---|---|
| PubChem CID | 175297001 |
| Molecular Formula | C23H19ClF5N5O3 |
| Molecular Weight | 543.88 g/mol |
| Exact Mass | 543.11 |
| IUPAC Name | 4-(4-chlorophenyl)-1-[[1-(2,5-difluorophenyl)-5-(1-hydroxyethyl)-1,2,4-triazol-3-yl]methyl]-3-(3,3,3-trifluoro-2-hydroxypropyl)imidazol-2-one |
| SMILES | CC(O)c1nc(Cn2cc(-c3ccc(Cl)cc3)n(CC(O)C(F)(F)F)c2=O)nn1-c1cc(F)ccc1F |
| InChI | InChI=1S/C23H19ClF5N5O3/c1-12(35)21-30-20(31-34(21)17-8-15(25)6-7-16(17)26)11-32-9-18(13-2-4-14(24)5-3-13)33(22(32)37)10-19(36)23(27,28)29/h2-9,12,19,35-36H,10-11H2,1H3 |
| InChIKey | UISTTZYBBQWRBV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 98.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.88 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |