C7H6O6 — CID 175297211
5-(hydroxymethyl)furan-2,3-dicarboxylic acid (PubChem CID 175297211) has the molecular formula C7H6O6 and a molecular weight of 186.12 g/mol. Its IUPAC name is 5-(hydroxymethyl)furan-2,3-dicarboxylic acid.
| Compound Name | 5-(hydroxymethyl)furan-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 175297211 |
| Molecular Formula | C7H6O6 |
| Molecular Weight | 186.12 g/mol |
| Exact Mass | 186.02 |
| IUPAC Name | 5-(hydroxymethyl)furan-2,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(CO)oc1C(=O)O |
| InChI | InChI=1S/C7H6O6/c8-2-3-1-4(6(9)10)5(13-3)7(11)12/h1,8H,2H2,(H,9,10)(H,11,12) |
| InChIKey | JVAZJYDSLJTNMI-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.12 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |