C22H24N6O5S — CID 175298191
[(3S)-1-[4-[(1S)-1-hydroxyethyl]-7-(2-methylphenyl)sulfonyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrrolidin-3-yl] carbamate (PubChem CID 175298191) has the molecular formula C22H24N6O5S and a molecular weight of 484.54 g/mol. Its IUPAC name is [(3S)-1-[4-[(1S)-1-hydroxyethyl]-7-(2-methylphenyl)sulfonyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrrolidin-3-yl] carbamate.
| Compound Name | [(3S)-1-[4-[(1S)-1-hydroxyethyl]-7-(2-methylphenyl)sulfonyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrrolidin-3-yl] carbamate |
|---|---|
| PubChem CID | 175298191 |
| Molecular Formula | C22H24N6O5S |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | [(3S)-1-[4-[(1S)-1-hydroxyethyl]-7-(2-methylphenyl)sulfonyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrrolidin-3-yl] carbamate |
| SMILES | Cc1ccccc1S(=O)(=O)c1nc2[nH]ccc2c2c1nc([C@H](C)O)n2N1CC[C@H](OC(N)=O)C1 |
| InChI | InChI=1S/C22H24N6O5S/c1-12-5-3-4-6-16(12)34(31,32)21-17-18(15-7-9-24-19(15)26-21)28(20(25-17)13(2)29)27-10-8-14(11-27)33-22(23)30/h3-7,9,13-14,29H,8,10-11H2,1-2H3,(H2,23,30)(H,24,26)/t13-,14-/m0/s1 |
| InChIKey | WFXJIWRNAOMGTC-KBPBESRZSA-N |
| XLogP | 1.91 |
| TPSA | 156.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |