About 4-tert-butyl-2-(1-ethylcyclohexa-2,4-dien-1-yl)phenol
4-tert-butyl-2-(1-ethylcyclohexa-2,4-dien-1-yl)phenol (PubChem CID 175298689) has the molecular formula C18H24O
and a molecular weight of 256.39 g/mol. Its IUPAC name is 4-tert-butyl-2-(1-ethylcyclohexa-2,4-dien-1-yl)phenol.
Molecular Properties
| Compound Name | 4-tert-butyl-2-(1-ethylcyclohexa-2,4-dien-1-yl)phenol |
| PubChem CID | 175298689 |
| Molecular Formula | C18H24O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 4-tert-butyl-2-(1-ethylcyclohexa-2,4-dien-1-yl)phenol |
| SMILES | CCC1(c2cc(C(C)(C)C)ccc2O)C=CC=CC1 |
| InChI | InChI=1S/C18H24O/c1-5-18(11-7-6-8-12-18)15-13-14(17(2,3)4)9-10-16(15)19/h6-11,13,19H,5,12H2,1-4H3 |
| InChIKey | WEAYFPAHWXIOKT-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-tert-butyl-2-(1-ethylcyclohexa-2,4-dien-1-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2-(1-ethylcyclohexa-2,4-dien-1-yl)phenol?
The IUPAC name of 4-tert-butyl-2-(1-ethylcyclohexa-2,4-dien-1-yl)phenol (CID 175298689) is 4-tert-butyl-2-(1-ethylcyclohexa-2,4-dien-1-yl)phenol.
What is the SMILES notation for 4-tert-butyl-2-(1-ethylcyclohexa-2,4-dien-1-yl)phenol?
The canonical SMILES for 4-tert-butyl-2-(1-ethylcyclohexa-2,4-dien-1-yl)phenol is CCC1(c2cc(C(C)(C)C)ccc2O)C=CC=CC1.
What is the InChIKey of 4-tert-butyl-2-(1-ethylcyclohexa-2,4-dien-1-yl)phenol?
The InChIKey is WEAYFPAHWXIOKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24O/c1-5-18(11-7-6-8-12-18)15-13-14(17(2,3)4)9-10-16(15)19/h6-11,13,19H,5,12H2,1-4H3.
What are the key properties of 4-tert-butyl-2-(1-ethylcyclohexa-2,4-dien-1-yl)phenol?
4-tert-butyl-2-(1-ethylcyclohexa-2,4-dien-1-yl)phenol has a molecular weight of 256.39 g/mol, XLogP of 4.85, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2-(1-ethylcyclohexa-2,4-dien-1-yl)phenol is sourced from PubChem (CID 175298689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).