About N-(4,6-dichloro-1H-pyrazolo[4,5-c]pyridin-7-yl)formamide
N-(4,6-dichloro-1H-pyrazolo[4,5-c]pyridin-7-yl)formamide (PubChem CID 175298701) has the molecular formula C7H4Cl2N4O
and a molecular weight of 231.04 g/mol. Its IUPAC name is N-(4,6-dichloro-1H-pyrazolo[4,5-c]pyridin-7-yl)formamide.
Molecular Properties
| Compound Name | N-(4,6-dichloro-1H-pyrazolo[4,5-c]pyridin-7-yl)formamide |
| PubChem CID | 175298701 |
| Molecular Formula | C7H4Cl2N4O |
| Molecular Weight | 231.04 g/mol |
| Exact Mass | 229.98 |
| IUPAC Name | N-(4,6-dichloro-1H-pyrazolo[4,5-c]pyridin-7-yl)formamide |
| SMILES | O=CNc1c(Cl)nc(Cl)c2cn[nH]c12 |
| InChI | InChI=1S/C7H4Cl2N4O/c8-6-3-1-11-13-4(3)5(10-2-14)7(9)12-6/h1-2H,(H,10,14)(H,11,13) |
| InChIKey | CGUSJRDHWWASJZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.04 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-(4,6-dichloro-1H-pyrazolo[4,5-c]pyridin-7-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,6-dichloro-1H-pyrazolo[4,5-c]pyridin-7-yl)formamide?
The IUPAC name of N-(4,6-dichloro-1H-pyrazolo[4,5-c]pyridin-7-yl)formamide (CID 175298701) is N-(4,6-dichloro-1H-pyrazolo[4,5-c]pyridin-7-yl)formamide.
What is the SMILES notation for N-(4,6-dichloro-1H-pyrazolo[4,5-c]pyridin-7-yl)formamide?
The canonical SMILES for N-(4,6-dichloro-1H-pyrazolo[4,5-c]pyridin-7-yl)formamide is O=CNc1c(Cl)nc(Cl)c2cn[nH]c12.
What is the InChIKey of N-(4,6-dichloro-1H-pyrazolo[4,5-c]pyridin-7-yl)formamide?
The InChIKey is CGUSJRDHWWASJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4Cl2N4O/c8-6-3-1-11-13-4(3)5(10-2-14)7(9)12-6/h1-2H,(H,10,14)(H,11,13).
What are the key properties of N-(4,6-dichloro-1H-pyrazolo[4,5-c]pyridin-7-yl)formamide?
N-(4,6-dichloro-1H-pyrazolo[4,5-c]pyridin-7-yl)formamide has a molecular weight of 231.04 g/mol, XLogP of 1.83, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,6-dichloro-1H-pyrazolo[4,5-c]pyridin-7-yl)formamide is sourced from PubChem (CID 175298701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).