About 2-propoxyethylideneurea
2-propoxyethylideneurea (PubChem CID 175299579) has the molecular formula C6H12N2O2
and a molecular weight of 144.17 g/mol. Its IUPAC name is 2-propoxyethylideneurea.
Molecular Properties
| Compound Name | 2-propoxyethylideneurea |
| PubChem CID | 175299579 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 2-propoxyethylideneurea |
| SMILES | CCCOCC=NC(N)=O |
| InChI | InChI=1S/C6H12N2O2/c1-2-4-10-5-3-8-6(7)9/h3H,2,4-5H2,1H3,(H2,7,9) |
| InChIKey | QJHHSNJISIROSB-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-propoxyethylideneurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propoxyethylideneurea?
The IUPAC name of 2-propoxyethylideneurea (CID 175299579) is 2-propoxyethylideneurea.
What is the SMILES notation for 2-propoxyethylideneurea?
The canonical SMILES for 2-propoxyethylideneurea is CCCOCC=NC(N)=O.
What is the InChIKey of 2-propoxyethylideneurea?
The InChIKey is QJHHSNJISIROSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2/c1-2-4-10-5-3-8-6(7)9/h3H,2,4-5H2,1H3,(H2,7,9).
What are the key properties of 2-propoxyethylideneurea?
2-propoxyethylideneurea has a molecular weight of 144.17 g/mol, XLogP of 0.56, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propoxyethylideneurea is sourced from PubChem (CID 175299579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).