About methyl formate;2-phenyl-1,4-thiazinane 1,1-dioxide
methyl formate;2-phenyl-1,4-thiazinane 1,1-dioxide (PubChem CID 175299719) has the molecular formula C12H17NO4S
and a molecular weight of 271.34 g/mol. Its IUPAC name is methyl formate;2-phenyl-1,4-thiazinane 1,1-dioxide.
Molecular Properties
| Compound Name | methyl formate;2-phenyl-1,4-thiazinane 1,1-dioxide |
| PubChem CID | 175299719 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | methyl formate;2-phenyl-1,4-thiazinane 1,1-dioxide |
| SMILES | COC=O.O=S1(=O)CCNCC1c1ccccc1 |
| InChI | InChI=1S/C10H13NO2S.C2H4O2/c12-14(13)7-6-11-8-10(14)9-4-2-1-3-5-9;1-4-2-3/h1-5,10-11H,6-8H2;2H,1H3 |
| InChIKey | XXAOHKPOCGBUQO-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methyl formate;2-phenyl-1,4-thiazinane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl formate;2-phenyl-1,4-thiazinane 1,1-dioxide?
The IUPAC name of methyl formate;2-phenyl-1,4-thiazinane 1,1-dioxide (CID 175299719) is methyl formate;2-phenyl-1,4-thiazinane 1,1-dioxide.
What is the SMILES notation for methyl formate;2-phenyl-1,4-thiazinane 1,1-dioxide?
The canonical SMILES for methyl formate;2-phenyl-1,4-thiazinane 1,1-dioxide is COC=O.O=S1(=O)CCNCC1c1ccccc1.
What is the InChIKey of methyl formate;2-phenyl-1,4-thiazinane 1,1-dioxide?
The InChIKey is XXAOHKPOCGBUQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2S.C2H4O2/c12-14(13)7-6-11-8-10(14)9-4-2-1-3-5-9;1-4-2-3/h1-5,10-11H,6-8H2;2H,1H3.
What are the key properties of methyl formate;2-phenyl-1,4-thiazinane 1,1-dioxide?
methyl formate;2-phenyl-1,4-thiazinane 1,1-dioxide has a molecular weight of 271.34 g/mol, XLogP of 0.53, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl formate;2-phenyl-1,4-thiazinane 1,1-dioxide is sourced from PubChem (CID 175299719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).