About 6-amino-5-methyl-1H-pyrimidin-2-one;6-amino-1H-pyrimidin-2-one;hydrate
6-amino-5-methyl-1H-pyrimidin-2-one;6-amino-1H-pyrimidin-2-one;hydrate (PubChem CID 175300459) has the molecular formula C9H14N6O3
and a molecular weight of 254.25 g/mol. Its IUPAC name is 6-amino-5-methyl-1H-pyrimidin-2-one;6-amino-1H-pyrimidin-2-one;hydrate.
Molecular Properties
| Compound Name | 6-amino-5-methyl-1H-pyrimidin-2-one;6-amino-1H-pyrimidin-2-one;hydrate |
| PubChem CID | 175300459 |
| Molecular Formula | C9H14N6O3 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 6-amino-5-methyl-1H-pyrimidin-2-one;6-amino-1H-pyrimidin-2-one;hydrate |
| SMILES | Cc1cnc(=O)[nH]c1N.Nc1ccnc(=O)[nH]1.O |
| InChI | InChI=1S/C5H7N3O.C4H5N3O.H2O/c1-3-2-7-5(9)8-4(3)6;5-3-1-2-6-4(8)7-3;/h2H,1H3,(H3,6,7,8,9);1-2H,(H3,5,6,7,8);1H2 |
| InChIKey | JOPIQZICJYFICL-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 175.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-amino-5-methyl-1H-pyrimidin-2-one;6-amino-1H-pyrimidin-2-one;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5-methyl-1H-pyrimidin-2-one;6-amino-1H-pyrimidin-2-one;hydrate?
The IUPAC name of 6-amino-5-methyl-1H-pyrimidin-2-one;6-amino-1H-pyrimidin-2-one;hydrate (CID 175300459) is 6-amino-5-methyl-1H-pyrimidin-2-one;6-amino-1H-pyrimidin-2-one;hydrate.
What is the SMILES notation for 6-amino-5-methyl-1H-pyrimidin-2-one;6-amino-1H-pyrimidin-2-one;hydrate?
The canonical SMILES for 6-amino-5-methyl-1H-pyrimidin-2-one;6-amino-1H-pyrimidin-2-one;hydrate is Cc1cnc(=O)[nH]c1N.Nc1ccnc(=O)[nH]1.O.
What is the InChIKey of 6-amino-5-methyl-1H-pyrimidin-2-one;6-amino-1H-pyrimidin-2-one;hydrate?
The InChIKey is JOPIQZICJYFICL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O.C4H5N3O.H2O/c1-3-2-7-5(9)8-4(3)6;5-3-1-2-6-4(8)7-3;/h2H,1H3,(H3,6,7,8,9);1-2H,(H3,5,6,7,8);1H2.
What are the key properties of 6-amino-5-methyl-1H-pyrimidin-2-one;6-amino-1H-pyrimidin-2-one;hydrate?
6-amino-5-methyl-1H-pyrimidin-2-one;6-amino-1H-pyrimidin-2-one;hydrate has a molecular weight of 254.25 g/mol, XLogP of -1.81, 0 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-methyl-1H-pyrimidin-2-one;6-amino-1H-pyrimidin-2-one;hydrate is sourced from PubChem (CID 175300459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).