About 2-piperidin-4-yl-1,5-naphthyridin-4-amine
2-piperidin-4-yl-1,5-naphthyridin-4-amine (PubChem CID 175301016) has the molecular formula C13H16N4
and a molecular weight of 228.30 g/mol. Its IUPAC name is 2-piperidin-4-yl-1,5-naphthyridin-4-amine.
Molecular Properties
| Compound Name | 2-piperidin-4-yl-1,5-naphthyridin-4-amine |
| PubChem CID | 175301016 |
| Molecular Formula | C13H16N4 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 2-piperidin-4-yl-1,5-naphthyridin-4-amine |
| SMILES | Nc1cc(C2CCNCC2)nc2cccnc12 |
| InChI | InChI=1S/C13H16N4/c14-10-8-12(9-3-6-15-7-4-9)17-11-2-1-5-16-13(10)11/h1-2,5,8-9,15H,3-4,6-7H2,(H2,14,17) |
| InChIKey | YOWNCVQGIXPKDP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-piperidin-4-yl-1,5-naphthyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-4-yl-1,5-naphthyridin-4-amine?
The IUPAC name of 2-piperidin-4-yl-1,5-naphthyridin-4-amine (CID 175301016) is 2-piperidin-4-yl-1,5-naphthyridin-4-amine.
What is the SMILES notation for 2-piperidin-4-yl-1,5-naphthyridin-4-amine?
The canonical SMILES for 2-piperidin-4-yl-1,5-naphthyridin-4-amine is Nc1cc(C2CCNCC2)nc2cccnc12.
What is the InChIKey of 2-piperidin-4-yl-1,5-naphthyridin-4-amine?
The InChIKey is YOWNCVQGIXPKDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4/c14-10-8-12(9-3-6-15-7-4-9)17-11-2-1-5-16-13(10)11/h1-2,5,8-9,15H,3-4,6-7H2,(H2,14,17).
What are the key properties of 2-piperidin-4-yl-1,5-naphthyridin-4-amine?
2-piperidin-4-yl-1,5-naphthyridin-4-amine has a molecular weight of 228.30 g/mol, XLogP of 1.68, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-4-yl-1,5-naphthyridin-4-amine is sourced from PubChem (CID 175301016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).