About 1-[2-(carbamoylamino)-1-chloroethyl]-1,3-bis(prop-2-enyl)urea
1-[2-(carbamoylamino)-1-chloroethyl]-1,3-bis(prop-2-enyl)urea (PubChem CID 175301104) has the molecular formula C10H17ClN4O2
and a molecular weight of 260.73 g/mol. Its IUPAC name is 1-[2-(carbamoylamino)-1-chloroethyl]-1,3-bis(prop-2-enyl)urea.
Molecular Properties
| Compound Name | 1-[2-(carbamoylamino)-1-chloroethyl]-1,3-bis(prop-2-enyl)urea |
| PubChem CID | 175301104 |
| Molecular Formula | C10H17ClN4O2 |
| Molecular Weight | 260.73 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 1-[2-(carbamoylamino)-1-chloroethyl]-1,3-bis(prop-2-enyl)urea |
| SMILES | C=CCNC(=O)N(CC=C)C(Cl)CNC(N)=O |
| InChI | InChI=1S/C10H17ClN4O2/c1-3-5-13-10(17)15(6-4-2)8(11)7-14-9(12)16/h3-4,8H,1-2,5-7H2,(H,13,17)(H3,12,14,16) |
| InChIKey | MDNKGPNWHLMPDH-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.73 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(carbamoylamino)-1-chloroethyl]-1,3-bis(prop-2-enyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(carbamoylamino)-1-chloroethyl]-1,3-bis(prop-2-enyl)urea?
The IUPAC name of 1-[2-(carbamoylamino)-1-chloroethyl]-1,3-bis(prop-2-enyl)urea (CID 175301104) is 1-[2-(carbamoylamino)-1-chloroethyl]-1,3-bis(prop-2-enyl)urea.
What is the SMILES notation for 1-[2-(carbamoylamino)-1-chloroethyl]-1,3-bis(prop-2-enyl)urea?
The canonical SMILES for 1-[2-(carbamoylamino)-1-chloroethyl]-1,3-bis(prop-2-enyl)urea is C=CCNC(=O)N(CC=C)C(Cl)CNC(N)=O.
What is the InChIKey of 1-[2-(carbamoylamino)-1-chloroethyl]-1,3-bis(prop-2-enyl)urea?
The InChIKey is MDNKGPNWHLMPDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17ClN4O2/c1-3-5-13-10(17)15(6-4-2)8(11)7-14-9(12)16/h3-4,8H,1-2,5-7H2,(H,13,17)(H3,12,14,16).
What are the key properties of 1-[2-(carbamoylamino)-1-chloroethyl]-1,3-bis(prop-2-enyl)urea?
1-[2-(carbamoylamino)-1-chloroethyl]-1,3-bis(prop-2-enyl)urea has a molecular weight of 260.73 g/mol, XLogP of 0.60, 7 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(carbamoylamino)-1-chloroethyl]-1,3-bis(prop-2-enyl)urea is sourced from PubChem (CID 175301104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).