About 5-butyl-1-ethyl-1,2-dimethyl-4-(3-methylbutyl)imidazol-1-ium tetrafluoroborate
5-butyl-1-ethyl-1,2-dimethyl-4-(3-methylbutyl)imidazol-1-ium tetrafluoroborate (PubChem CID 175301785) has the molecular formula C16H31BF4N2
and a molecular weight of 338.24 g/mol. Its IUPAC name is 5-butyl-1-ethyl-1,2-dimethyl-4-(3-methylbutyl)imidazol-1-ium tetrafluoroborate.
Molecular Properties
| Compound Name | 5-butyl-1-ethyl-1,2-dimethyl-4-(3-methylbutyl)imidazol-1-ium tetrafluoroborate |
| PubChem CID | 175301785 |
| Molecular Formula | C16H31BF4N2 |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 5-butyl-1-ethyl-1,2-dimethyl-4-(3-methylbutyl)imidazol-1-ium tetrafluoroborate |
| SMILES | CCCCC1=C(CCC(C)C)N=C(C)[N+]1(C)CC.F[B-](F)(F)F |
| InChI | InChI=1S/C16H31N2.BF4/c1-7-9-10-16-15(12-11-13(3)4)17-14(5)18(16,6)8-2;2-1(3,4)5/h13H,7-12H2,1-6H3;/q+1;-1 |
| InChIKey | HBWFAKXSMIRGDT-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 5-butyl-1-ethyl-1,2-dimethyl-4-(3-methylbutyl)imidazol-1-ium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-1-ethyl-1,2-dimethyl-4-(3-methylbutyl)imidazol-1-ium tetrafluoroborate?
The IUPAC name of 5-butyl-1-ethyl-1,2-dimethyl-4-(3-methylbutyl)imidazol-1-ium tetrafluoroborate (CID 175301785) is 5-butyl-1-ethyl-1,2-dimethyl-4-(3-methylbutyl)imidazol-1-ium tetrafluoroborate.
What is the SMILES notation for 5-butyl-1-ethyl-1,2-dimethyl-4-(3-methylbutyl)imidazol-1-ium tetrafluoroborate?
The canonical SMILES for 5-butyl-1-ethyl-1,2-dimethyl-4-(3-methylbutyl)imidazol-1-ium tetrafluoroborate is CCCCC1=C(CCC(C)C)N=C(C)[N+]1(C)CC.F[B-](F)(F)F.
What is the InChIKey of 5-butyl-1-ethyl-1,2-dimethyl-4-(3-methylbutyl)imidazol-1-ium tetrafluoroborate?
The InChIKey is HBWFAKXSMIRGDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31N2.BF4/c1-7-9-10-16-15(12-11-13(3)4)17-14(5)18(16,6)8-2;2-1(3,4)5/h13H,7-12H2,1-6H3;/q+1;-1.
What are the key properties of 5-butyl-1-ethyl-1,2-dimethyl-4-(3-methylbutyl)imidazol-1-ium tetrafluoroborate?
5-butyl-1-ethyl-1,2-dimethyl-4-(3-methylbutyl)imidazol-1-ium tetrafluoroborate has a molecular weight of 338.24 g/mol, XLogP of 6.02, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-1-ethyl-1,2-dimethyl-4-(3-methylbutyl)imidazol-1-ium tetrafluoroborate is sourced from PubChem (CID 175301785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).