About disilanylsilyl 2,3-dimethylbut-2-enoate
disilanylsilyl 2,3-dimethylbut-2-enoate (PubChem CID 175301912) has the molecular formula C6H16O2Si3
and a molecular weight of 204.45 g/mol. Its IUPAC name is disilanylsilyl 2,3-dimethylbut-2-enoate.
Molecular Properties
| Compound Name | disilanylsilyl 2,3-dimethylbut-2-enoate |
| PubChem CID | 175301912 |
| Molecular Formula | C6H16O2Si3 |
| Molecular Weight | 204.45 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | disilanylsilyl 2,3-dimethylbut-2-enoate |
| SMILES | CC(C)=C(C)C(=O)O[SiH2][SiH2][SiH3] |
| InChI | InChI=1S/C6H16O2Si3/c1-4(2)5(3)6(7)8-10-11-9/h10-11H2,1-3,9H3 |
| InChIKey | ZKDMJWFMMLNDFN-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.45 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze disilanylsilyl 2,3-dimethylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disilanylsilyl 2,3-dimethylbut-2-enoate?
The IUPAC name of disilanylsilyl 2,3-dimethylbut-2-enoate (CID 175301912) is disilanylsilyl 2,3-dimethylbut-2-enoate.
What is the SMILES notation for disilanylsilyl 2,3-dimethylbut-2-enoate?
The canonical SMILES for disilanylsilyl 2,3-dimethylbut-2-enoate is CC(C)=C(C)C(=O)O[SiH2][SiH2][SiH3].
What is the InChIKey of disilanylsilyl 2,3-dimethylbut-2-enoate?
The InChIKey is ZKDMJWFMMLNDFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O2Si3/c1-4(2)5(3)6(7)8-10-11-9/h10-11H2,1-3,9H3.
What are the key properties of disilanylsilyl 2,3-dimethylbut-2-enoate?
disilanylsilyl 2,3-dimethylbut-2-enoate has a molecular weight of 204.45 g/mol, XLogP of -1.67, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for disilanylsilyl 2,3-dimethylbut-2-enoate is sourced from PubChem (CID 175301912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).