About 1-[(4-methoxyphenyl)methyl]-2,4,6-triphenyl-2H-pyridine tetrafluoroborate
1-[(4-methoxyphenyl)methyl]-2,4,6-triphenyl-2H-pyridine tetrafluoroborate (PubChem CID 175302704) has the molecular formula C31H27BF4NO-
and a molecular weight of 516.37 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-2,4,6-triphenyl-2H-pyridine tetrafluoroborate.
Molecular Properties
| Compound Name | 1-[(4-methoxyphenyl)methyl]-2,4,6-triphenyl-2H-pyridine tetrafluoroborate |
| PubChem CID | 175302704 |
| Molecular Formula | C31H27BF4NO- |
| Molecular Weight | 516.37 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-2,4,6-triphenyl-2H-pyridine tetrafluoroborate |
| SMILES | COc1ccc(CN2C(c3ccccc3)=CC(c3ccccc3)=CC2c2ccccc2)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C31H27NO.BF4/c1-33-29-19-17-24(18-20-29)23-32-30(26-13-7-3-8-14-26)21-28(25-11-5-2-6-12-25)22-31(32)27-15-9-4-10-16-27;2-1(3,4)5/h2-22,30H,23H2,1H3;/q;-1 |
| InChIKey | GTJOOQCDFIKMMV-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 516.37 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4-methoxyphenyl)methyl]-2,4,6-triphenyl-2H-pyridine tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-methoxyphenyl)methyl]-2,4,6-triphenyl-2H-pyridine tetrafluoroborate?
The IUPAC name of 1-[(4-methoxyphenyl)methyl]-2,4,6-triphenyl-2H-pyridine tetrafluoroborate (CID 175302704) is 1-[(4-methoxyphenyl)methyl]-2,4,6-triphenyl-2H-pyridine tetrafluoroborate.
What is the SMILES notation for 1-[(4-methoxyphenyl)methyl]-2,4,6-triphenyl-2H-pyridine tetrafluoroborate?
The canonical SMILES for 1-[(4-methoxyphenyl)methyl]-2,4,6-triphenyl-2H-pyridine tetrafluoroborate is COc1ccc(CN2C(c3ccccc3)=CC(c3ccccc3)=CC2c2ccccc2)cc1.F[B-](F)(F)F.
What is the InChIKey of 1-[(4-methoxyphenyl)methyl]-2,4,6-triphenyl-2H-pyridine tetrafluoroborate?
The InChIKey is GTJOOQCDFIKMMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H27NO.BF4/c1-33-29-19-17-24(18-20-29)23-32-30(26-13-7-3-8-14-26)21-28(25-11-5-2-6-12-25)22-31(32)27-15-9-4-10-16-27;2-1(3,4)5/h2-22,30H,23H2,1H3;/q;-1.
What are the key properties of 1-[(4-methoxyphenyl)methyl]-2,4,6-triphenyl-2H-pyridine tetrafluoroborate?
1-[(4-methoxyphenyl)methyl]-2,4,6-triphenyl-2H-pyridine tetrafluoroborate has a molecular weight of 516.37 g/mol, XLogP of 8.68, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-methoxyphenyl)methyl]-2,4,6-triphenyl-2H-pyridine tetrafluoroborate is sourced from PubChem (CID 175302704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).