C11H4ClF10NO2 — CID 175302795
4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-hydroxy-2-(trifluoromethoxy)benzenecarboximidoyl chloride (PubChem CID 175302795) has the molecular formula C11H4ClF10NO2 and a molecular weight of 407.59 g/mol. Its IUPAC name is 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-hydroxy-2-(trifluoromethoxy)benzenecarboximidoyl chloride.
| Compound Name | 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-hydroxy-2-(trifluoromethoxy)benzenecarboximidoyl chloride |
|---|---|
| PubChem CID | 175302795 |
| Molecular Formula | C11H4ClF10NO2 |
| Molecular Weight | 407.59 g/mol |
| Exact Mass | 406.98 |
| IUPAC Name | 4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-hydroxy-2-(trifluoromethoxy)benzenecarboximidoyl chloride |
| SMILES | ON=C(Cl)c1ccc(C(F)(C(F)(F)F)C(F)(F)F)cc1OC(F)(F)F |
| InChI | InChI=1S/C11H4ClF10NO2/c12-7(23-24)5-2-1-4(3-6(5)25-11(20,21)22)8(13,9(14,15)16)10(17,18)19/h1-3,24H |
| InChIKey | OJXOIUZNSAVEHX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.59 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|