About 3-butyl-1-methylcyclohex-4-ene-1,3-dicarboxylic acid;hydron;tetrafluoroborate
3-butyl-1-methylcyclohex-4-ene-1,3-dicarboxylic acid;hydron;tetrafluoroborate (PubChem CID 175302912) has the molecular formula C13H21BF4O4
and a molecular weight of 328.11 g/mol. Its IUPAC name is 3-butyl-1-methylcyclohex-4-ene-1,3-dicarboxylic acid;hydron;tetrafluoroborate.
Molecular Properties
| Compound Name | 3-butyl-1-methylcyclohex-4-ene-1,3-dicarboxylic acid;hydron;tetrafluoroborate |
| PubChem CID | 175302912 |
| Molecular Formula | C13H21BF4O4 |
| Molecular Weight | 328.11 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 3-butyl-1-methylcyclohex-4-ene-1,3-dicarboxylic acid;hydron;tetrafluoroborate |
| SMILES | CCCCC1(C(=O)O)C=CCC(C)(C(=O)O)C1.F[B-](F)(F)F.[H+] |
| InChI | InChI=1S/C13H20O4.BF4/c1-3-4-7-13(11(16)17)8-5-6-12(2,9-13)10(14)15;2-1(3,4)5/h5,8H,3-4,6-7,9H2,1-2H3,(H,14,15)(H,16,17);/q;-1/p+1 |
| InChIKey | QDBMWVANTVIWDE-UHFFFAOYSA-O |
| XLogP | 4.10 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.11 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-butyl-1-methylcyclohex-4-ene-1,3-dicarboxylic acid;hydron;tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-1-methylcyclohex-4-ene-1,3-dicarboxylic acid;hydron;tetrafluoroborate?
The IUPAC name of 3-butyl-1-methylcyclohex-4-ene-1,3-dicarboxylic acid;hydron;tetrafluoroborate (CID 175302912) is 3-butyl-1-methylcyclohex-4-ene-1,3-dicarboxylic acid;hydron;tetrafluoroborate.
What is the SMILES notation for 3-butyl-1-methylcyclohex-4-ene-1,3-dicarboxylic acid;hydron;tetrafluoroborate?
The canonical SMILES for 3-butyl-1-methylcyclohex-4-ene-1,3-dicarboxylic acid;hydron;tetrafluoroborate is CCCCC1(C(=O)O)C=CCC(C)(C(=O)O)C1.F[B-](F)(F)F.[H+].
What is the InChIKey of 3-butyl-1-methylcyclohex-4-ene-1,3-dicarboxylic acid;hydron;tetrafluoroborate?
The InChIKey is QDBMWVANTVIWDE-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H20O4.BF4/c1-3-4-7-13(11(16)17)8-5-6-12(2,9-13)10(14)15;2-1(3,4)5/h5,8H,3-4,6-7,9H2,1-2H3,(H,14,15)(H,16,17);/q;-1/p+1.
What are the key properties of 3-butyl-1-methylcyclohex-4-ene-1,3-dicarboxylic acid;hydron;tetrafluoroborate?
3-butyl-1-methylcyclohex-4-ene-1,3-dicarboxylic acid;hydron;tetrafluoroborate has a molecular weight of 328.11 g/mol, XLogP of 4.10, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-1-methylcyclohex-4-ene-1,3-dicarboxylic acid;hydron;tetrafluoroborate is sourced from PubChem (CID 175302912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).