About 2-(hydroxymethyl)-3-(4-prop-2-enylhepta-1,6-dien-4-yl)butane-1,4-diol
2-(hydroxymethyl)-3-(4-prop-2-enylhepta-1,6-dien-4-yl)butane-1,4-diol (PubChem CID 175303105) has the molecular formula C15H26O3
and a molecular weight of 254.37 g/mol. Its IUPAC name is 2-(hydroxymethyl)-3-(4-prop-2-enylhepta-1,6-dien-4-yl)butane-1,4-diol.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-3-(4-prop-2-enylhepta-1,6-dien-4-yl)butane-1,4-diol |
| PubChem CID | 175303105 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 2-(hydroxymethyl)-3-(4-prop-2-enylhepta-1,6-dien-4-yl)butane-1,4-diol |
| SMILES | C=CCC(CC=C)(CC=C)C(CO)C(CO)CO |
| InChI | InChI=1S/C15H26O3/c1-4-7-15(8-5-2,9-6-3)14(12-18)13(10-16)11-17/h4-6,13-14,16-18H,1-3,7-12H2 |
| InChIKey | LBFPPGRWPQNFKL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(hydroxymethyl)-3-(4-prop-2-enylhepta-1,6-dien-4-yl)butane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-3-(4-prop-2-enylhepta-1,6-dien-4-yl)butane-1,4-diol?
The IUPAC name of 2-(hydroxymethyl)-3-(4-prop-2-enylhepta-1,6-dien-4-yl)butane-1,4-diol (CID 175303105) is 2-(hydroxymethyl)-3-(4-prop-2-enylhepta-1,6-dien-4-yl)butane-1,4-diol.
What is the SMILES notation for 2-(hydroxymethyl)-3-(4-prop-2-enylhepta-1,6-dien-4-yl)butane-1,4-diol?
The canonical SMILES for 2-(hydroxymethyl)-3-(4-prop-2-enylhepta-1,6-dien-4-yl)butane-1,4-diol is C=CCC(CC=C)(CC=C)C(CO)C(CO)CO.
What is the InChIKey of 2-(hydroxymethyl)-3-(4-prop-2-enylhepta-1,6-dien-4-yl)butane-1,4-diol?
The InChIKey is LBFPPGRWPQNFKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O3/c1-4-7-15(8-5-2,9-6-3)14(12-18)13(10-16)11-17/h4-6,13-14,16-18H,1-3,7-12H2.
What are the key properties of 2-(hydroxymethyl)-3-(4-prop-2-enylhepta-1,6-dien-4-yl)butane-1,4-diol?
2-(hydroxymethyl)-3-(4-prop-2-enylhepta-1,6-dien-4-yl)butane-1,4-diol has a molecular weight of 254.37 g/mol, XLogP of 1.91, 11 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-3-(4-prop-2-enylhepta-1,6-dien-4-yl)butane-1,4-diol is sourced from PubChem (CID 175303105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).