C28H30N6O2S — CID 175303211
5,7,11-triamino-6-oxo-7-(2-phenyl-4-pyridinyl)-N-piperidin-3-yl-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carboxamide (PubChem CID 175303211) has the molecular formula C28H30N6O2S and a molecular weight of 514.66 g/mol. Its IUPAC name is 5,7,11-triamino-6-oxo-7-(2-phenyl-4-pyridinyl)-N-piperidin-3-yl-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carboxamide.
| Compound Name | 5,7,11-triamino-6-oxo-7-(2-phenyl-4-pyridinyl)-N-piperidin-3-yl-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carboxamide |
|---|---|
| PubChem CID | 175303211 |
| Molecular Formula | C28H30N6O2S |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | 5,7,11-triamino-6-oxo-7-(2-phenyl-4-pyridinyl)-N-piperidin-3-yl-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),8(12),9-triene-3-carboxamide |
| SMILES | Nc1ccc2c3c1SC(C(=O)NC1CCCNC1)C3C(N)C(=O)C2(N)c1ccnc(-c2ccccc2)c1 |
| InChI | InChI=1S/C28H30N6O2S/c29-19-9-8-18-21-22(25(37-24(19)21)27(36)34-17-7-4-11-32-14-17)23(30)26(35)28(18,31)16-10-12-33-20(13-16)15-5-2-1-3-6-15/h1-3,5-6,8-10,12-13,17,22-23,25,32H,4,7,11,14,29-31H2,(H,34,36) |
| InChIKey | SZQJVYDMNLOHFP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 149.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|