About 2-amino-2-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]acetic acid;hydrate
2-amino-2-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]acetic acid;hydrate (PubChem CID 175303338) has the molecular formula C9H11NO4
and a molecular weight of 197.19 g/mol. Its IUPAC name is 2-amino-2-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]acetic acid;hydrate.
Molecular Properties
| Compound Name | 2-amino-2-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]acetic acid;hydrate |
| PubChem CID | 175303338 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 2-amino-2-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]acetic acid;hydrate |
| SMILES | NC(C(=O)O)C1C=CC=CC1=C=O.O |
| InChI | InChI=1S/C9H9NO3.H2O/c10-8(9(12)13)7-4-2-1-3-6(7)5-11;/h1-4,7-8H,10H2,(H,12,13);1H2 |
| InChIKey | QFYBIKOZCURFFO-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-2-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]acetic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]acetic acid;hydrate?
The IUPAC name of 2-amino-2-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]acetic acid;hydrate (CID 175303338) is 2-amino-2-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]acetic acid;hydrate.
What is the SMILES notation for 2-amino-2-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]acetic acid;hydrate?
The canonical SMILES for 2-amino-2-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]acetic acid;hydrate is NC(C(=O)O)C1C=CC=CC1=C=O.O.
What is the InChIKey of 2-amino-2-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]acetic acid;hydrate?
The InChIKey is QFYBIKOZCURFFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3.H2O/c10-8(9(12)13)7-4-2-1-3-6(7)5-11;/h1-4,7-8H,10H2,(H,12,13);1H2.
What are the key properties of 2-amino-2-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]acetic acid;hydrate?
2-amino-2-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]acetic acid;hydrate has a molecular weight of 197.19 g/mol, XLogP of -0.93, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]acetic acid;hydrate is sourced from PubChem (CID 175303338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).