C18H24O10 — CID 175303803
3,6-dioxabicyclo[6.2.2]dodeca-1(10),8,11-triene-2,7-dione;ethane-1,2-diol;hexanedioic acid (PubChem CID 175303803) has the molecular formula C18H24O10 and a molecular weight of 400.38 g/mol. Its IUPAC name is 3,6-dioxabicyclo[6.2.2]dodeca-1(10),8,11-triene-2,7-dione;ethane-1,2-diol;hexanedioic acid.
| Compound Name | 3,6-dioxabicyclo[6.2.2]dodeca-1(10),8,11-triene-2,7-dione;ethane-1,2-diol;hexanedioic acid |
|---|---|
| PubChem CID | 175303803 |
| Molecular Formula | C18H24O10 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 3,6-dioxabicyclo[6.2.2]dodeca-1(10),8,11-triene-2,7-dione;ethane-1,2-diol;hexanedioic acid |
| SMILES | O=C(O)CCCCC(=O)O.O=C1OCCOC(=O)c2ccc1cc2.OCCO |
| InChI | InChI=1S/C10H8O4.C6H10O4.C2H6O2/c11-9-7-1-2-8(4-3-7)10(12)14-6-5-13-9;7-5(8)3-1-2-4-6(9)10;3-1-2-4/h1-4H,5-6H2;1-4H2,(H,7,8)(H,9,10);3-4H,1-2H2 |
| InChIKey | OONZMUIIHAKURF-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|