About [1,1,1-trifluoro-3-(1H-pyrazol-4-yl)propan-2-yl] formate
[1,1,1-trifluoro-3-(1H-pyrazol-4-yl)propan-2-yl] formate (PubChem CID 175304028) has the molecular formula C7H7F3N2O2
and a molecular weight of 208.14 g/mol. Its IUPAC name is [1,1,1-trifluoro-3-(1H-pyrazol-4-yl)propan-2-yl] formate.
Molecular Properties
| Compound Name | [1,1,1-trifluoro-3-(1H-pyrazol-4-yl)propan-2-yl] formate |
| PubChem CID | 175304028 |
| Molecular Formula | C7H7F3N2O2 |
| Molecular Weight | 208.14 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | [1,1,1-trifluoro-3-(1H-pyrazol-4-yl)propan-2-yl] formate |
| SMILES | O=COC(Cc1cn[nH]c1)C(F)(F)F |
| InChI | InChI=1S/C7H7F3N2O2/c8-7(9,10)6(14-4-13)1-5-2-11-12-3-5/h2-4,6H,1H2,(H,11,12) |
| InChIKey | BTRVKHNRRBBAMY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.14 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [1,1,1-trifluoro-3-(1H-pyrazol-4-yl)propan-2-yl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,1,1-trifluoro-3-(1H-pyrazol-4-yl)propan-2-yl] formate?
The IUPAC name of [1,1,1-trifluoro-3-(1H-pyrazol-4-yl)propan-2-yl] formate (CID 175304028) is [1,1,1-trifluoro-3-(1H-pyrazol-4-yl)propan-2-yl] formate.
What is the SMILES notation for [1,1,1-trifluoro-3-(1H-pyrazol-4-yl)propan-2-yl] formate?
The canonical SMILES for [1,1,1-trifluoro-3-(1H-pyrazol-4-yl)propan-2-yl] formate is O=COC(Cc1cn[nH]c1)C(F)(F)F.
What is the InChIKey of [1,1,1-trifluoro-3-(1H-pyrazol-4-yl)propan-2-yl] formate?
The InChIKey is BTRVKHNRRBBAMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F3N2O2/c8-7(9,10)6(14-4-13)1-5-2-11-12-3-5/h2-4,6H,1H2,(H,11,12).
What are the key properties of [1,1,1-trifluoro-3-(1H-pyrazol-4-yl)propan-2-yl] formate?
[1,1,1-trifluoro-3-(1H-pyrazol-4-yl)propan-2-yl] formate has a molecular weight of 208.14 g/mol, XLogP of 1.06, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1,1,1-trifluoro-3-(1H-pyrazol-4-yl)propan-2-yl] formate is sourced from PubChem (CID 175304028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).