C10H11F9N2O3 — CID 175304090
N'-(4,4,5,5,6,6,7,7,7-nonafluoro-2-hydroxyheptyl)propanediamide (PubChem CID 175304090) has the molecular formula C10H11F9N2O3 and a molecular weight of 378.19 g/mol. Its IUPAC name is N'-(4,4,5,5,6,6,7,7,7-nonafluoro-2-hydroxyheptyl)propanediamide.
| Compound Name | N'-(4,4,5,5,6,6,7,7,7-nonafluoro-2-hydroxyheptyl)propanediamide |
|---|---|
| PubChem CID | 175304090 |
| Molecular Formula | C10H11F9N2O3 |
| Molecular Weight | 378.19 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | N'-(4,4,5,5,6,6,7,7,7-nonafluoro-2-hydroxyheptyl)propanediamide |
| SMILES | NC(=O)CC(=O)NCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H11F9N2O3/c11-7(12,8(13,14)9(15,16)10(17,18)19)2-4(22)3-21-6(24)1-5(20)23/h4,22H,1-3H2,(H2,20,23)(H,21,24) |
| InChIKey | DGRMEKPTNVBDDW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.19 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|