C12H11F13N2O3 — CID 175304107
N'-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hydroxynonyl)propanediamide (PubChem CID 175304107) has the molecular formula C12H11F13N2O3 and a molecular weight of 478.21 g/mol. Its IUPAC name is N'-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hydroxynonyl)propanediamide.
| Compound Name | N'-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hydroxynonyl)propanediamide |
|---|---|
| PubChem CID | 175304107 |
| Molecular Formula | C12H11F13N2O3 |
| Molecular Weight | 478.21 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | N'-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hydroxynonyl)propanediamide |
| SMILES | NC(=O)CC(=O)NCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H11F13N2O3/c13-7(14,2-4(28)3-27-6(30)1-5(26)29)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)25/h4,28H,1-3H2,(H2,26,29)(H,27,30) |
| InChIKey | UYJZPOCUBFDCHX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.21 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|