About 2-hydroxy-3-(1,3-thiazol-2-yl)-5-(trifluoromethyl)benzonitrile
2-hydroxy-3-(1,3-thiazol-2-yl)-5-(trifluoromethyl)benzonitrile (PubChem CID 175304132) has the molecular formula C11H5F3N2OS
and a molecular weight of 270.24 g/mol. Its IUPAC name is 2-hydroxy-3-(1,3-thiazol-2-yl)-5-(trifluoromethyl)benzonitrile.
Molecular Properties
| Compound Name | 2-hydroxy-3-(1,3-thiazol-2-yl)-5-(trifluoromethyl)benzonitrile |
| PubChem CID | 175304132 |
| Molecular Formula | C11H5F3N2OS |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 2-hydroxy-3-(1,3-thiazol-2-yl)-5-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1cc(C(F)(F)F)cc(-c2nccs2)c1O |
| InChI | InChI=1S/C11H5F3N2OS/c12-11(13,14)7-3-6(5-15)9(17)8(4-7)10-16-1-2-18-10/h1-4,17H |
| InChIKey | VAMUQUXOLHTPLO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxy-3-(1,3-thiazol-2-yl)-5-(trifluoromethyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3-(1,3-thiazol-2-yl)-5-(trifluoromethyl)benzonitrile?
The IUPAC name of 2-hydroxy-3-(1,3-thiazol-2-yl)-5-(trifluoromethyl)benzonitrile (CID 175304132) is 2-hydroxy-3-(1,3-thiazol-2-yl)-5-(trifluoromethyl)benzonitrile.
What is the SMILES notation for 2-hydroxy-3-(1,3-thiazol-2-yl)-5-(trifluoromethyl)benzonitrile?
The canonical SMILES for 2-hydroxy-3-(1,3-thiazol-2-yl)-5-(trifluoromethyl)benzonitrile is N#Cc1cc(C(F)(F)F)cc(-c2nccs2)c1O.
What is the InChIKey of 2-hydroxy-3-(1,3-thiazol-2-yl)-5-(trifluoromethyl)benzonitrile?
The InChIKey is VAMUQUXOLHTPLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5F3N2OS/c12-11(13,14)7-3-6(5-15)9(17)8(4-7)10-16-1-2-18-10/h1-4,17H.
What are the key properties of 2-hydroxy-3-(1,3-thiazol-2-yl)-5-(trifluoromethyl)benzonitrile?
2-hydroxy-3-(1,3-thiazol-2-yl)-5-(trifluoromethyl)benzonitrile has a molecular weight of 270.24 g/mol, XLogP of 3.41, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3-(1,3-thiazol-2-yl)-5-(trifluoromethyl)benzonitrile is sourced from PubChem (CID 175304132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).