About N,N-dimethylformamide;formaldehyde;pyrrolidine-1-sulfinate
N,N-dimethylformamide;formaldehyde;pyrrolidine-1-sulfinate (PubChem CID 175304572) has the molecular formula C8H17N2O4S-
and a molecular weight of 237.30 g/mol. Its IUPAC name is N,N-dimethylformamide;formaldehyde;pyrrolidine-1-sulfinate.
Molecular Properties
| Compound Name | N,N-dimethylformamide;formaldehyde;pyrrolidine-1-sulfinate |
| PubChem CID | 175304572 |
| Molecular Formula | C8H17N2O4S- |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | N,N-dimethylformamide;formaldehyde;pyrrolidine-1-sulfinate |
| SMILES | C=O.CN(C)C=O.O=S([O-])N1CCCC1 |
| InChI | InChI=1S/C4H9NO2S.C3H7NO.CH2O/c6-8(7)5-3-1-2-4-5;1-4(2)3-5;1-2/h1-4H2,(H,6,7);3H,1-2H3;1H2/p-1 |
| InChIKey | YVVFNZWZXSXFMY-UHFFFAOYSA-M |
| XLogP | -0.60 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylformamide;formaldehyde;pyrrolidine-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylformamide;formaldehyde;pyrrolidine-1-sulfinate?
The IUPAC name of N,N-dimethylformamide;formaldehyde;pyrrolidine-1-sulfinate (CID 175304572) is N,N-dimethylformamide;formaldehyde;pyrrolidine-1-sulfinate.
What is the SMILES notation for N,N-dimethylformamide;formaldehyde;pyrrolidine-1-sulfinate?
The canonical SMILES for N,N-dimethylformamide;formaldehyde;pyrrolidine-1-sulfinate is C=O.CN(C)C=O.O=S([O-])N1CCCC1.
What is the InChIKey of N,N-dimethylformamide;formaldehyde;pyrrolidine-1-sulfinate?
The InChIKey is YVVFNZWZXSXFMY-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H9NO2S.C3H7NO.CH2O/c6-8(7)5-3-1-2-4-5;1-4(2)3-5;1-2/h1-4H2,(H,6,7);3H,1-2H3;1H2/p-1.
What are the key properties of N,N-dimethylformamide;formaldehyde;pyrrolidine-1-sulfinate?
N,N-dimethylformamide;formaldehyde;pyrrolidine-1-sulfinate has a molecular weight of 237.30 g/mol, XLogP of -0.60, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylformamide;formaldehyde;pyrrolidine-1-sulfinate is sourced from PubChem (CID 175304572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).