About [2-[(1,3-dioxobenzo[de]isoquinolin-4-yl)-prop-2-enoyloxyamino]-2-oxoethyl] prop-2-enoate
[2-[(1,3-dioxobenzo[de]isoquinolin-4-yl)-prop-2-enoyloxyamino]-2-oxoethyl] prop-2-enoate (PubChem CID 175304576) has the molecular formula C20H14N2O7
and a molecular weight of 394.34 g/mol. Its IUPAC name is [2-[(1,3-dioxobenzo[de]isoquinolin-4-yl)-prop-2-enoyloxyamino]-2-oxoethyl] prop-2-enoate.
Molecular Properties
| Compound Name | [2-[(1,3-dioxobenzo[de]isoquinolin-4-yl)-prop-2-enoyloxyamino]-2-oxoethyl] prop-2-enoate |
| PubChem CID | 175304576 |
| Molecular Formula | C20H14N2O7 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | [2-[(1,3-dioxobenzo[de]isoquinolin-4-yl)-prop-2-enoyloxyamino]-2-oxoethyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(=O)N(OC(=O)C=C)c1ccc2cccc3c2c1C(=O)NC3=O |
| InChI | InChI=1S/C20H14N2O7/c1-3-15(24)28-10-14(23)22(29-16(25)4-2)13-9-8-11-6-5-7-12-17(11)18(13)20(27)21-19(12)26/h3-9H,1-2,10H2,(H,21,26,27) |
| InChIKey | MVTFZLKGJGWPSG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [2-[(1,3-dioxobenzo[de]isoquinolin-4-yl)-prop-2-enoyloxyamino]-2-oxoethyl] prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(1,3-dioxobenzo[de]isoquinolin-4-yl)-prop-2-enoyloxyamino]-2-oxoethyl] prop-2-enoate?
The IUPAC name of [2-[(1,3-dioxobenzo[de]isoquinolin-4-yl)-prop-2-enoyloxyamino]-2-oxoethyl] prop-2-enoate (CID 175304576) is [2-[(1,3-dioxobenzo[de]isoquinolin-4-yl)-prop-2-enoyloxyamino]-2-oxoethyl] prop-2-enoate.
What is the SMILES notation for [2-[(1,3-dioxobenzo[de]isoquinolin-4-yl)-prop-2-enoyloxyamino]-2-oxoethyl] prop-2-enoate?
The canonical SMILES for [2-[(1,3-dioxobenzo[de]isoquinolin-4-yl)-prop-2-enoyloxyamino]-2-oxoethyl] prop-2-enoate is C=CC(=O)OCC(=O)N(OC(=O)C=C)c1ccc2cccc3c2c1C(=O)NC3=O.
What is the InChIKey of [2-[(1,3-dioxobenzo[de]isoquinolin-4-yl)-prop-2-enoyloxyamino]-2-oxoethyl] prop-2-enoate?
The InChIKey is MVTFZLKGJGWPSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N2O7/c1-3-15(24)28-10-14(23)22(29-16(25)4-2)13-9-8-11-6-5-7-12-17(11)18(13)20(27)21-19(12)26/h3-9H,1-2,10H2,(H,21,26,27).
What are the key properties of [2-[(1,3-dioxobenzo[de]isoquinolin-4-yl)-prop-2-enoyloxyamino]-2-oxoethyl] prop-2-enoate?
[2-[(1,3-dioxobenzo[de]isoquinolin-4-yl)-prop-2-enoyloxyamino]-2-oxoethyl] prop-2-enoate has a molecular weight of 394.34 g/mol, XLogP of 1.43, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(1,3-dioxobenzo[de]isoquinolin-4-yl)-prop-2-enoyloxyamino]-2-oxoethyl] prop-2-enoate is sourced from PubChem (CID 175304576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).