C27H29N5O3 — CID 175304722
1-[2-[[4-[2-(3,5-dimethoxyphenyl)ethynyl]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]amino]-6-azaspiro[3.5]nonan-6-yl]prop-2-en-1-one (PubChem CID 175304722) has the molecular formula C27H29N5O3 and a molecular weight of 471.56 g/mol. Its IUPAC name is 1-[2-[[4-[2-(3,5-dimethoxyphenyl)ethynyl]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]amino]-6-azaspiro[3.5]nonan-6-yl]prop-2-en-1-one.
| Compound Name | 1-[2-[[4-[2-(3,5-dimethoxyphenyl)ethynyl]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]amino]-6-azaspiro[3.5]nonan-6-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 175304722 |
| Molecular Formula | C27H29N5O3 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 1-[2-[[4-[2-(3,5-dimethoxyphenyl)ethynyl]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]amino]-6-azaspiro[3.5]nonan-6-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC2(CC(Nc3c[nH]c4ncnc(C#Cc5cc(OC)cc(OC)c5)c34)C2)C1 |
| InChI | InChI=1S/C27H29N5O3/c1-4-24(33)32-9-5-8-27(16-32)13-19(14-27)31-23-15-28-26-25(23)22(29-17-30-26)7-6-18-10-20(34-2)12-21(11-18)35-3/h4,10-12,15,17,19,31H,1,5,8-9,13-14,16H2,2-3H3,(H,28,29,30) |
| InChIKey | SOQGXBKPAXCBRJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|