About 2-(3-bromo-4-chlorophenyl)-1H-pyrrole;pyridine
2-(3-bromo-4-chlorophenyl)-1H-pyrrole;pyridine (PubChem CID 175305128) has the molecular formula C15H12BrClN2
and a molecular weight of 335.63 g/mol. Its IUPAC name is 2-(3-bromo-4-chlorophenyl)-1H-pyrrole;pyridine.
Molecular Properties
| Compound Name | 2-(3-bromo-4-chlorophenyl)-1H-pyrrole;pyridine |
| PubChem CID | 175305128 |
| Molecular Formula | C15H12BrClN2 |
| Molecular Weight | 335.63 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 2-(3-bromo-4-chlorophenyl)-1H-pyrrole;pyridine |
| SMILES | Clc1ccc(-c2ccc[nH]2)cc1Br.c1ccncc1 |
| InChI | InChI=1S/C10H7BrClN.C5H5N/c11-8-6-7(3-4-9(8)12)10-2-1-5-13-10;1-2-4-6-5-3-1/h1-6,13H;1-5H |
| InChIKey | KDLZDQKSOJCFET-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.63 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(3-bromo-4-chlorophenyl)-1H-pyrrole;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromo-4-chlorophenyl)-1H-pyrrole;pyridine?
The IUPAC name of 2-(3-bromo-4-chlorophenyl)-1H-pyrrole;pyridine (CID 175305128) is 2-(3-bromo-4-chlorophenyl)-1H-pyrrole;pyridine.
What is the SMILES notation for 2-(3-bromo-4-chlorophenyl)-1H-pyrrole;pyridine?
The canonical SMILES for 2-(3-bromo-4-chlorophenyl)-1H-pyrrole;pyridine is Clc1ccc(-c2ccc[nH]2)cc1Br.c1ccncc1.
What is the InChIKey of 2-(3-bromo-4-chlorophenyl)-1H-pyrrole;pyridine?
The InChIKey is KDLZDQKSOJCFET-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrClN.C5H5N/c11-8-6-7(3-4-9(8)12)10-2-1-5-13-10;1-2-4-6-5-3-1/h1-6,13H;1-5H.
What are the key properties of 2-(3-bromo-4-chlorophenyl)-1H-pyrrole;pyridine?
2-(3-bromo-4-chlorophenyl)-1H-pyrrole;pyridine has a molecular weight of 335.63 g/mol, XLogP of 5.18, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromo-4-chlorophenyl)-1H-pyrrole;pyridine is sourced from PubChem (CID 175305128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).