C24H27N — CID 175305298
cyclohexa-1,3-diene;7,8,9,10,11,12-hexahydrochrysen-1-amine (PubChem CID 175305298) has the molecular formula C24H27N and a molecular weight of 329.49 g/mol. Its IUPAC name is cyclohexa-1,3-diene;7,8,9,10,11,12-hexahydrochrysen-1-amine.
| Compound Name | cyclohexa-1,3-diene;7,8,9,10,11,12-hexahydrochrysen-1-amine |
|---|---|
| PubChem CID | 175305298 |
| Molecular Formula | C24H27N |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | cyclohexa-1,3-diene;7,8,9,10,11,12-hexahydrochrysen-1-amine |
| SMILES | C1=CCCC=C1.Nc1cccc2c1CCc1c-2ccc2c1CCCC2 |
| InChI | InChI=1S/C18H19N.C6H8/c19-18-7-3-6-14-16-9-8-12-4-1-2-5-13(12)15(16)10-11-17(14)18;1-2-4-6-5-3-1/h3,6-9H,1-2,4-5,10-11,19H2;1-4H,5-6H2 |
| InChIKey | FBRTYNJBBQCYOM-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|